C10H11ClO4 — CID 162955570
methyl (1R,5R)-5-chloro-1-hydroxy-4-oxo-2-prop-1-enylcyclopent-2-ene-1-carboxylate (PubChem CID 162955570) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is methyl (1R,5R)-5-chloro-1-hydroxy-4-oxo-2-prop-1-enylcyclopent-2-ene-1-carboxylate.
| Compound Name | methyl (1R,5R)-5-chloro-1-hydroxy-4-oxo-2-prop-1-enylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 162955570 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | methyl (1R,5R)-5-chloro-1-hydroxy-4-oxo-2-prop-1-enylcyclopent-2-ene-1-carboxylate |
| SMILES | CC=CC1=CC(=O)[C@H](Cl)[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C10H11ClO4/c1-3-4-6-5-7(12)8(11)10(6,14)9(13)15-2/h3-5,8,14H,1-2H3/t8-,10-/m0/s1 |
| InChIKey | HSATYRFYDXEDDB-WPRPVWTQSA-N |
| XLogP | 0.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|