C20H24O5 — CID 162955576
(3aS,6aR,7R,8S,10aR)-7-[2-(furan-3-yl)ethyl]-3a-hydroxy-7,8-dimethyl-6,6a,8,10-tetrahydro-1H-benzo[d][2]benzofuran-3,9-dione (PubChem CID 162955576) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3aS,6aR,7R,8S,10aR)-7-[2-(furan-3-yl)ethyl]-3a-hydroxy-7,8-dimethyl-6,6a,8,10-tetrahydro-1H-benzo[d][2]benzofuran-3,9-dione.
| Compound Name | (3aS,6aR,7R,8S,10aR)-7-[2-(furan-3-yl)ethyl]-3a-hydroxy-7,8-dimethyl-6,6a,8,10-tetrahydro-1H-benzo[d][2]benzofuran-3,9-dione |
|---|---|
| PubChem CID | 162955576 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3aS,6aR,7R,8S,10aR)-7-[2-(furan-3-yl)ethyl]-3a-hydroxy-7,8-dimethyl-6,6a,8,10-tetrahydro-1H-benzo[d][2]benzofuran-3,9-dione |
| SMILES | C[C@@H]1C(=O)C[C@@]23COC(=O)[C@]2(O)C=CC[C@@H]3[C@@]1(C)CCc1ccoc1 |
| InChI | InChI=1S/C20H24O5/c1-13-15(21)10-19-12-25-17(22)20(19,23)7-3-4-16(19)18(13,2)8-5-14-6-9-24-11-14/h3,6-7,9,11,13,16,23H,4-5,8,10,12H2,1-2H3/t13-,16-,18+,19+,20-/m1/s1 |
| InChIKey | ZSAXQVPCWVATOG-PPOOEBMNSA-N |
| XLogP | 2.68 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|