C9H16N4O4 — CID 162958029
4-amino-5-(aminodiazenyl)-3-(methoxymethoxy)cyclohexene-1-carboxylic acid (PubChem CID 162958029) has the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-amino-5-(aminodiazenyl)-3-(methoxymethoxy)cyclohexene-1-carboxylic acid.
| Compound Name | 4-amino-5-(aminodiazenyl)-3-(methoxymethoxy)cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 162958029 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-amino-5-(aminodiazenyl)-3-(methoxymethoxy)cyclohexene-1-carboxylic acid |
| SMILES | COCOC1C=C(C(=O)O)CC(/N=N/N)C1N |
| InChI | InChI=1S/C9H16N4O4/c1-16-4-17-7-3-5(9(14)15)2-6(8(7)10)12-13-11/h3,6-8H,2,4,10H2,1H3,(H2,11,12)(H,14,15) |
| InChIKey | VZZHSARKWNEPAY-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|