C23H33NO6S — CID 162959845
2-[[5-[[(2R,4S,4aS,8aS)-2,4,8,8a-tetramethyl-1,3,4,4a,5,6-hexahydronaphthalen-2-yl]methyl]-6-hydroxy-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]ethanesulfonic acid (PubChem CID 162959845) has the molecular formula C23H33NO6S and a molecular weight of 451.59 g/mol. Its IUPAC name is 2-[[5-[[(2R,4S,4aS,8aS)-2,4,8,8a-tetramethyl-1,3,4,4a,5,6-hexahydronaphthalen-2-yl]methyl]-6-hydroxy-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[5-[[(2R,4S,4aS,8aS)-2,4,8,8a-tetramethyl-1,3,4,4a,5,6-hexahydronaphthalen-2-yl]methyl]-6-hydroxy-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 162959845 |
| Molecular Formula | C23H33NO6S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 2-[[5-[[(2R,4S,4aS,8aS)-2,4,8,8a-tetramethyl-1,3,4,4a,5,6-hexahydronaphthalen-2-yl]methyl]-6-hydroxy-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]ethanesulfonic acid |
| SMILES | CC1=CCC[C@H]2[C@@H](C)C[C@@](C)(CC3=C(O)C(NCCS(=O)(=O)O)=CC(=O)C3=O)C[C@]12C |
| InChI | InChI=1S/C23H33NO6S/c1-14-11-22(3,13-23(4)15(2)6-5-7-17(14)23)12-16-20(26)18(10-19(25)21(16)27)24-8-9-31(28,29)30/h6,10,14,17,24,26H,5,7-9,11-13H2,1-4H3,(H,28,29,30)/t14-,17-,22-,23+/m0/s1 |
| InChIKey | IPSXJHPWMDESTD-HWZVDDMOSA-N |
| XLogP | 3.50 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|