C23H30O6 — CID 162963831
(1S,4S,5R,6R,7S)-3-[(2R)-but-3-en-2-yl]-4-hydroxy-1-methoxy-7-methyl-6-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-2-en-8-one (PubChem CID 162963831) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is (1S,4S,5R,6R,7S)-3-[(2R)-but-3-en-2-yl]-4-hydroxy-1-methoxy-7-methyl-6-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-2-en-8-one.
| Compound Name | (1S,4S,5R,6R,7S)-3-[(2R)-but-3-en-2-yl]-4-hydroxy-1-methoxy-7-methyl-6-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-2-en-8-one |
|---|---|
| PubChem CID | 162963831 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (1S,4S,5R,6R,7S)-3-[(2R)-but-3-en-2-yl]-4-hydroxy-1-methoxy-7-methyl-6-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-2-en-8-one |
| SMILES | C=C[C@@H](C)C1=C[C@]2(OC)C(=O)[C@H]([C@H](c3cc(OC)c(OC)c(OC)c3)[C@@H]2C)[C@@H]1O |
| InChI | InChI=1S/C23H30O6/c1-8-12(2)15-11-23(29-7)13(3)18(19(20(15)24)22(23)25)14-9-16(26-4)21(28-6)17(10-14)27-5/h8-13,18-20,24H,1H2,2-7H3/t12-,13+,18+,19-,20-,23-/m1/s1 |
| InChIKey | YDRWYOIIJZEAQQ-YSPRHIIJSA-N |
| XLogP | 3.14 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|