C20H27F3N2O8S — CID 162974930
methyl (2R)-3-methyl-2-[[(1R,3R,4R,5S)-1,3,4-trihydroxy-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]butanoate (PubChem CID 162974930) has the molecular formula C20H27F3N2O8S and a molecular weight of 512.50 g/mol. Its IUPAC name is methyl (2R)-3-methyl-2-[[(1R,3R,4R,5S)-1,3,4-trihydroxy-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]butanoate.
| Compound Name | methyl (2R)-3-methyl-2-[[(1R,3R,4R,5S)-1,3,4-trihydroxy-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 162974930 |
| Molecular Formula | C20H27F3N2O8S |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | methyl (2R)-3-methyl-2-[[(1R,3R,4R,5S)-1,3,4-trihydroxy-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]butanoate |
| SMILES | COC(=O)[C@H](NC(=O)[C@]1(O)C[C@@H](O)[C@H](O)[C@@H](NS(=O)(=O)c2cccc(C(F)(F)F)c2)C1)C(C)C |
| InChI | InChI=1S/C20H27F3N2O8S/c1-10(2)15(17(28)33-3)24-18(29)19(30)8-13(16(27)14(26)9-19)25-34(31,32)12-6-4-5-11(7-12)20(21,22)23/h4-7,10,13-16,25-27,30H,8-9H2,1-3H3,(H,24,29)/t13-,14+,15+,16+,19+/m0/s1 |
| InChIKey | OKCOTARZEAQDRC-YAFCLFEMSA-N |
| XLogP | -0.09 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |