C25H31N3O3 — CID 162984275
(7R,13S,20R)-20-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18-triene-9,22-dione (PubChem CID 162984275) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is (7R,13S,20R)-20-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18-triene-9,22-dione.
| Compound Name | (7R,13S,20R)-20-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18-triene-9,22-dione |
|---|---|
| PubChem CID | 162984275 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (7R,13S,20R)-20-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18-triene-9,22-dione |
| SMILES | O=C1C[C@H](c2ccccc2)NCCCCN2C(=O)C[C@@H](O)c3ccccc3[C@@H]2CCN1 |
| InChI | InChI=1S/C25H31N3O3/c29-23-17-25(31)28-15-7-6-13-26-21(18-8-2-1-3-9-18)16-24(30)27-14-12-22(28)19-10-4-5-11-20(19)23/h1-5,8-11,21-23,26,29H,6-7,12-17H2,(H,27,30)/t21-,22+,23-/m1/s1 |
| InChIKey | GVNAXAQMUCAYRC-XPWALMASSA-N |
| XLogP | 3.01 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |