C30H44O9 — CID 162989479
[(1S,2S,3aS,5E,9R,11R,12E,13aS)-1,3a,9-triacetyloxy-2,5,8,8,12-pentamethyl-4-oxo-1,2,3,7,9,10,11,13a-octahydrocyclopenta[12]annulen-11-yl] butanoate (PubChem CID 162989479) has the molecular formula C30H44O9 and a molecular weight of 548.67 g/mol. Its IUPAC name is [(1S,2S,3aS,5E,9R,11R,12E,13aS)-1,3a,9-triacetyloxy-2,5,8,8,12-pentamethyl-4-oxo-1,2,3,7,9,10,11,13a-octahydrocyclopenta[12]annulen-11-yl] butanoate.
| Compound Name | [(1S,2S,3aS,5E,9R,11R,12E,13aS)-1,3a,9-triacetyloxy-2,5,8,8,12-pentamethyl-4-oxo-1,2,3,7,9,10,11,13a-octahydrocyclopenta[12]annulen-11-yl] butanoate |
|---|---|
| PubChem CID | 162989479 |
| Molecular Formula | C30H44O9 |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | [(1S,2S,3aS,5E,9R,11R,12E,13aS)-1,3a,9-triacetyloxy-2,5,8,8,12-pentamethyl-4-oxo-1,2,3,7,9,10,11,13a-octahydrocyclopenta[12]annulen-11-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1C[C@@H](OC(C)=O)C(C)(C)C/C=C(\C)C(=O)[C@]2(OC(C)=O)C[C@H](C)[C@H](OC(C)=O)[C@@H]2/C=C/1C |
| InChI | InChI=1S/C30H44O9/c1-10-11-26(34)38-24-15-25(36-20(5)31)29(8,9)13-12-17(2)28(35)30(39-22(7)33)16-19(4)27(37-21(6)32)23(30)14-18(24)3/h12,14,19,23-25,27H,10-11,13,15-16H2,1-9H3/b17-12+,18-14+/t19-,23-,24+,25+,27-,30-/m0/s1 |
| InChIKey | SPTLPXYWCRWOMK-RSYLYXQQSA-N |
| XLogP | 4.80 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|