C34H58O2 — CID 162996030
(2S,3S)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(3R,7S)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxiran-2-yl]ethyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane (PubChem CID 162996030) has the molecular formula C34H58O2 and a molecular weight of 498.84 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(3R,7S)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxiran-2-yl]ethyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane.
| Compound Name | (2S,3S)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(3R,7S)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxiran-2-yl]ethyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane |
|---|---|
| PubChem CID | 162996030 |
| Molecular Formula | C34H58O2 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 498.44 |
| IUPAC Name | (2S,3S)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(3R,7S)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxiran-2-yl]ethyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane |
| SMILES | C=C(C)[C@H](C)CCC(=C)[C@H](C)CC[C@]1(C)O[C@H]1CC[C@@H]1O[C@@]1(C)CC[C@@H](C)C(=C)CC[C@H](C)C(=C)C |
| InChI | InChI=1S/C34H58O2/c1-23(2)25(5)13-15-27(7)29(9)19-21-33(11)31(35-33)17-18-32-34(12,36-32)22-20-30(10)28(8)16-14-26(6)24(3)4/h25-26,29-32H,1,3,7-8,13-22H2,2,4-6,9-12H3/t25-,26+,29-,30-,31+,32+,33+,34+/m1/s1 |
| InChIKey | VLNDRZCVAMLVJF-OFZDVSKBSA-N |
| XLogP | 10.01 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|