C16H20N2O8S2 — CID 162996184
[2-(1H-indol-3-yl)-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methylsulfanyl]ethylidene]sulfamic acid (PubChem CID 162996184) has the molecular formula C16H20N2O8S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methylsulfanyl]ethylidene]sulfamic acid.
| Compound Name | [2-(1H-indol-3-yl)-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methylsulfanyl]ethylidene]sulfamic acid |
|---|---|
| PubChem CID | 162996184 |
| Molecular Formula | C16H20N2O8S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [2-(1H-indol-3-yl)-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methylsulfanyl]ethylidene]sulfamic acid |
| SMILES | O=S(=O)(O)N=C(Cc1c[nH]c2ccccc12)SCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C16H20N2O8S2/c19-13-11(26-16(22)15(21)14(13)20)7-27-12(18-28(23,24)25)5-8-6-17-10-4-2-1-3-9(8)10/h1-4,6,11,13-17,19-22H,5,7H2,(H,23,24,25) |
| InChIKey | UNJPDKUSINOKDF-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|