C15H22O4 — CID 163000598
(5S,5aR,6R,7S,8aR)-6-hydroxy-7-(hydroxymethyl)-5,7-dimethyl-1,4,5,5a,6,8,8a,9-octahydroazuleno[5,6-c]furan-3-one (PubChem CID 163000598) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (5S,5aR,6R,7S,8aR)-6-hydroxy-7-(hydroxymethyl)-5,7-dimethyl-1,4,5,5a,6,8,8a,9-octahydroazuleno[5,6-c]furan-3-one.
| Compound Name | (5S,5aR,6R,7S,8aR)-6-hydroxy-7-(hydroxymethyl)-5,7-dimethyl-1,4,5,5a,6,8,8a,9-octahydroazuleno[5,6-c]furan-3-one |
|---|---|
| PubChem CID | 163000598 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (5S,5aR,6R,7S,8aR)-6-hydroxy-7-(hydroxymethyl)-5,7-dimethyl-1,4,5,5a,6,8,8a,9-octahydroazuleno[5,6-c]furan-3-one |
| SMILES | C[C@H]1CC2=C(COC2=O)C[C@@H]2C[C@@](C)(CO)[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C15H22O4/c1-8-3-11-10(6-19-14(11)18)4-9-5-15(2,7-16)13(17)12(8)9/h8-9,12-13,16-17H,3-7H2,1-2H3/t8-,9+,12+,13+,15-/m0/s1 |
| InChIKey | XNCROXXXRUTAOE-KLDWPMRUSA-N |
| XLogP | 1.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |