C25H24O5 — CID 163005465
(2S,7S,16R,17S)-10,10,16,17-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11-tetraene-4,18-dione (PubChem CID 163005465) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is (2S,7S,16R,17S)-10,10,16,17-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11-tetraene-4,18-dione.
| Compound Name | (2S,7S,16R,17S)-10,10,16,17-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11-tetraene-4,18-dione |
|---|---|
| PubChem CID | 163005465 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (2S,7S,16R,17S)-10,10,16,17-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),5,8(13),11-tetraene-4,18-dione |
| SMILES | C[C@@H]1C(=O)C2=C(O[C@@H]1C)C1=C(OC(C)(C)C=C1)[C@H]1C(c3ccccc3)=CC(=O)O[C@H]21 |
| InChI | InChI=1S/C25H24O5/c1-13-14(2)28-22-16-10-11-25(3,4)30-23(16)19-17(15-8-6-5-7-9-15)12-18(26)29-24(19)20(22)21(13)27/h5-14,19,24H,1-4H3/t13-,14+,19+,24-/m0/s1 |
| InChIKey | AURANRRSUJGVOJ-LHVNUXSJSA-N |
| XLogP | 4.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |