C20H20O6 — CID 163007138
(1S,13R,15S)-15-(furan-3-yl)-13-methyl-6,16-dioxatricyclo[11.4.0.04,8]heptadeca-4(8),9-diene-7,12,17-trione (PubChem CID 163007138) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (1S,13R,15S)-15-(furan-3-yl)-13-methyl-6,16-dioxatricyclo[11.4.0.04,8]heptadeca-4(8),9-diene-7,12,17-trione.
| Compound Name | (1S,13R,15S)-15-(furan-3-yl)-13-methyl-6,16-dioxatricyclo[11.4.0.04,8]heptadeca-4(8),9-diene-7,12,17-trione |
|---|---|
| PubChem CID | 163007138 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (1S,13R,15S)-15-(furan-3-yl)-13-methyl-6,16-dioxatricyclo[11.4.0.04,8]heptadeca-4(8),9-diene-7,12,17-trione |
| SMILES | C[C@@]12C[C@@H](c3ccoc3)OC(=O)[C@H]1CCC1=C(C=CCC2=O)C(=O)OC1 |
| InChI | InChI=1S/C20H20O6/c1-20-9-16(13-7-8-24-10-13)26-19(23)15(20)6-5-12-11-25-18(22)14(12)3-2-4-17(20)21/h2-3,7-8,10,15-16H,4-6,9,11H2,1H3/t15-,16+,20-/m1/s1 |
| InChIKey | VGBNOFOWNHRFOS-GQIGUUNPSA-N |
| XLogP | 3.05 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |