C23H29NO4 — CID 163015039
(1R,10S)-14-ethyl-3,4,5-trimethoxy-18-methyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one (PubChem CID 163015039) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is (1R,10S)-14-ethyl-3,4,5-trimethoxy-18-methyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one.
| Compound Name | (1R,10S)-14-ethyl-3,4,5-trimethoxy-18-methyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one |
|---|---|
| PubChem CID | 163015039 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (1R,10S)-14-ethyl-3,4,5-trimethoxy-18-methyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one |
| SMILES | CCC1=C[C@@]23CCN(C)[C@@H](CCc4cc(OC)c(OC)c(OC)c42)C3=CC1=O |
| InChI | InChI=1S/C23H29NO4/c1-6-14-13-23-9-10-24(2)17(16(23)12-18(14)25)8-7-15-11-19(26-3)21(27-4)22(28-5)20(15)23/h11-13,17H,6-10H2,1-5H3/t17-,23+/m0/s1 |
| InChIKey | RHTHBCVSUTVZBX-GAJHUEQPSA-N |
| XLogP | 3.45 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |