C22H27NO5 — CID 122405717
(10S,16S)-3,4,5,14-tetramethoxy-18-methyl-16-tritio-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one (PubChem CID 122405717) has the molecular formula C22H27NO5 and a molecular weight of 387.47 g/mol. Its IUPAC name is (10S,16S)-3,4,5,14-tetramethoxy-18-methyl-16-tritio-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one.
| Compound Name | (10S,16S)-3,4,5,14-tetramethoxy-18-methyl-16-tritio-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one |
|---|---|
| PubChem CID | 122405717 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (10S,16S)-3,4,5,14-tetramethoxy-18-methyl-16-tritio-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one |
| SMILES | [3H][C@@H]1CN(C)[C@H]2CCc3cc(OC)c(OC)c(OC)c3C13C=C(OC)C(=O)C=C23 |
| InChI | InChI=1S/C22H27NO5/c1-23-9-8-22-12-18(26-3)16(24)11-14(22)15(23)7-6-13-10-17(25-2)20(27-4)21(28-5)19(13)22/h10-12,15H,6-9H2,1-5H3/t15-,22?/m0/s1/i8T/t8-,15+,22?/m1 |
| InChIKey | AYPIIWGCGUQVNZ-VGUBQRPCSA-N |
| XLogP | 2.64 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |