C18H19NO4 — CID 163005733
(1R,9S)-5-hydroxy-4,13-dimethoxy-16-methyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6,10,13-pentaen-12-one (PubChem CID 163005733) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (1R,9S)-5-hydroxy-4,13-dimethoxy-16-methyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6,10,13-pentaen-12-one.
| Compound Name | (1R,9S)-5-hydroxy-4,13-dimethoxy-16-methyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6,10,13-pentaen-12-one |
|---|---|
| PubChem CID | 163005733 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (1R,9S)-5-hydroxy-4,13-dimethoxy-16-methyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6,10,13-pentaen-12-one |
| SMILES | COC1=C[C@@]23CN(C)[C@@H](Cc4cc(O)c(OC)cc42)C3=CC1=O |
| InChI | InChI=1S/C18H19NO4/c1-19-9-18-8-17(23-3)15(21)6-12(18)13(19)4-10-5-14(20)16(22-2)7-11(10)18/h5-8,13,20H,4,9H2,1-3H3/t13-,18+/m0/s1 |
| InChIKey | QVMWIKOFPJHMAJ-SCLBCKFNSA-N |
| XLogP | 1.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |