C23H24O8 — CID 163020165
(3S,3aS,6R,6aR)-3,6-bis(1,3-benzodioxol-5-ylmethyl)-3-methoxy-1,4,6,6a-tetrahydrofuro[3,4-c]furan-3a-ol (PubChem CID 163020165) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is (3S,3aS,6R,6aR)-3,6-bis(1,3-benzodioxol-5-ylmethyl)-3-methoxy-1,4,6,6a-tetrahydrofuro[3,4-c]furan-3a-ol.
| Compound Name | (3S,3aS,6R,6aR)-3,6-bis(1,3-benzodioxol-5-ylmethyl)-3-methoxy-1,4,6,6a-tetrahydrofuro[3,4-c]furan-3a-ol |
|---|---|
| PubChem CID | 163020165 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (3S,3aS,6R,6aR)-3,6-bis(1,3-benzodioxol-5-ylmethyl)-3-methoxy-1,4,6,6a-tetrahydrofuro[3,4-c]furan-3a-ol |
| SMILES | CO[C@@]1(Cc2ccc3c(c2)OCO3)OC[C@@H]2[C@@H](Cc3ccc4c(c3)OCO4)OC[C@@]21O |
| InChI | InChI=1S/C23H24O8/c1-25-23(9-15-3-5-18-21(8-15)30-13-28-18)22(24)11-26-19(16(22)10-31-23)6-14-2-4-17-20(7-14)29-12-27-17/h2-5,7-8,16,19,24H,6,9-13H2,1H3/t16-,19-,22-,23+/m1/s1 |
| InChIKey | DOHWIZQQMDSAHJ-SAVREHANSA-N |
| XLogP | 2.05 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |