C29H42O8 — CID 163020404
2,16-dihydroxy-4,4,10,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 163020404) has the molecular formula C29H42O8 and a molecular weight of 518.65 g/mol. Its IUPAC name is 2,16-dihydroxy-4,4,10,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | 2,16-dihydroxy-4,4,10,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 163020404 |
| Molecular Formula | C29H42O8 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2,16-dihydroxy-4,4,10,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CC1(C)C(=O)C(O)=CC2(C)C1=CCC1C2C(=O)CC2(C)C1CC(O)C2C(C)(O)C(=O)CC(O)C(C)(C)O |
| InChI | InChI=1S/C29H42O8/c1-25(2)19-9-8-14-15-10-16(30)23(29(7,37)21(34)11-20(33)26(3,4)36)27(15,5)12-17(31)22(14)28(19,6)13-18(32)24(25)35/h9,13-16,20,22-23,30,32-33,36-37H,8,10-12H2,1-7H3 |
| InChIKey | LJINSKLQQVKVAS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|