C9H16O2S2 — CID 163021507
(1R,2R,3S,4R,5S)-2-hydroxysulfanyl-3,4-dimethyl-5-prop-2-enylthiolane 1-oxide (PubChem CID 163021507) has the molecular formula C9H16O2S2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-2-hydroxysulfanyl-3,4-dimethyl-5-prop-2-enylthiolane 1-oxide.
| Compound Name | (1R,2R,3S,4R,5S)-2-hydroxysulfanyl-3,4-dimethyl-5-prop-2-enylthiolane 1-oxide |
|---|---|
| PubChem CID | 163021507 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (1R,2R,3S,4R,5S)-2-hydroxysulfanyl-3,4-dimethyl-5-prop-2-enylthiolane 1-oxide |
| SMILES | C=CC[C@H]1[C@H](C)[C@H](C)[C@H](SO)[S@@]1=O |
| InChI | InChI=1S/C9H16O2S2/c1-4-5-8-6(2)7(3)9(12-10)13(8)11/h4,6-10H,1,5H2,2-3H3/t6-,7+,8+,9-,13-/m1/s1 |
| InChIKey | BWCBRBXZARMWOF-PFKOVSBFSA-N |
| XLogP | 2.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|