C12H20O2S4 — CID 162918148
(1S,2R,3R,4S,5R)-3,4-dimethyl-2-(prop-2-enyldisulfanyl)-5-[(S)-prop-1-enylsulfinyl]thiolane 1-oxide (PubChem CID 162918148) has the molecular formula C12H20O2S4 and a molecular weight of 324.56 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R)-3,4-dimethyl-2-(prop-2-enyldisulfanyl)-5-[(S)-prop-1-enylsulfinyl]thiolane 1-oxide.
| Compound Name | (1S,2R,3R,4S,5R)-3,4-dimethyl-2-(prop-2-enyldisulfanyl)-5-[(S)-prop-1-enylsulfinyl]thiolane 1-oxide |
|---|---|
| PubChem CID | 162918148 |
| Molecular Formula | C12H20O2S4 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (1S,2R,3R,4S,5R)-3,4-dimethyl-2-(prop-2-enyldisulfanyl)-5-[(S)-prop-1-enylsulfinyl]thiolane 1-oxide |
| SMILES | C=CCSS[C@@H]1[C@H](C)[C@H](C)[C@H]([S@@](=O)C=CC)[S@@]1=O |
| InChI | InChI=1S/C12H20O2S4/c1-5-7-15-16-11-9(3)10(4)12(18(11)14)17(13)8-6-2/h5-6,8-12H,1,7H2,2-4H3/t9-,10+,11+,12-,17+,18-/m1/s1 |
| InChIKey | ZAZVWEDJVOFUSP-DHBBCTFTSA-N |
| XLogP | 3.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|