C9H14OS3 — CID 156587604
3,4-dimethyl-5-(prop-2-enyldisulfanyl)thiolan-2-one (PubChem CID 156587604) has the molecular formula C9H14OS3 and a molecular weight of 234.41 g/mol. Its IUPAC name is 3,4-dimethyl-5-(prop-2-enyldisulfanyl)thiolan-2-one.
| Compound Name | 3,4-dimethyl-5-(prop-2-enyldisulfanyl)thiolan-2-one |
|---|---|
| PubChem CID | 156587604 |
| Molecular Formula | C9H14OS3 |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 3,4-dimethyl-5-(prop-2-enyldisulfanyl)thiolan-2-one |
| SMILES | C=CCSSC1SC(=O)C(C)C1C |
| InChI | InChI=1S/C9H14OS3/c1-4-5-11-13-9-7(3)6(2)8(10)12-9/h4,6-7,9H,1,5H2,2-3H3 |
| InChIKey | CROCCBHEZBXMOV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|