C12H20OS5 — CID 132526345
(2R,3S)-5-methyl-2-(prop-2-enyldisulfanyl)-3-[(prop-2-enyldisulfanyl)methyl]thiolane 1-oxide (PubChem CID 132526345) has the molecular formula C12H20OS5 and a molecular weight of 340.63 g/mol. Its IUPAC name is (2R,3S)-5-methyl-2-(prop-2-enyldisulfanyl)-3-[(prop-2-enyldisulfanyl)methyl]thiolane 1-oxide.
| Compound Name | (2R,3S)-5-methyl-2-(prop-2-enyldisulfanyl)-3-[(prop-2-enyldisulfanyl)methyl]thiolane 1-oxide |
|---|---|
| PubChem CID | 132526345 |
| Molecular Formula | C12H20OS5 |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | (2R,3S)-5-methyl-2-(prop-2-enyldisulfanyl)-3-[(prop-2-enyldisulfanyl)methyl]thiolane 1-oxide |
| SMILES | C=CCSSC[C@@H]1CC(C)S(=O)[C@@H]1SSCC=C |
| InChI | InChI=1S/C12H20OS5/c1-4-6-14-16-9-11-8-10(3)18(13)12(11)17-15-7-5-2/h4-5,10-12H,1-2,6-9H2,3H3/t10?,11-,12-,18?/m0/s1 |
| InChIKey | YIKXZSDUDUXISS-ICBQKXGSSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|