C16H25NO3S — CID 163028802
(1S,2S,5S,6S,8S,9R,11S)-5-isothiocyanato-5,9-dimethyl-2-propan-2-yl-10-oxatricyclo[6.2.1.01,6]undecane-9,11-diol (PubChem CID 163028802) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (1S,2S,5S,6S,8S,9R,11S)-5-isothiocyanato-5,9-dimethyl-2-propan-2-yl-10-oxatricyclo[6.2.1.01,6]undecane-9,11-diol.
| Compound Name | (1S,2S,5S,6S,8S,9R,11S)-5-isothiocyanato-5,9-dimethyl-2-propan-2-yl-10-oxatricyclo[6.2.1.01,6]undecane-9,11-diol |
|---|---|
| PubChem CID | 163028802 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (1S,2S,5S,6S,8S,9R,11S)-5-isothiocyanato-5,9-dimethyl-2-propan-2-yl-10-oxatricyclo[6.2.1.01,6]undecane-9,11-diol |
| SMILES | CC(C)[C@@H]1CC[C@](C)(N=C=S)[C@@H]2C[C@H]3[C@H](O)[C@@]21O[C@@]3(C)O |
| InChI | InChI=1S/C16H25NO3S/c1-9(2)10-5-6-14(3,17-8-21)12-7-11-13(18)16(10,12)20-15(11,4)19/h9-13,18-19H,5-7H2,1-4H3/t10-,11-,12-,13-,14-,15+,16-/m0/s1 |
| InChIKey | APGMRVREUPWQPH-ZNHNDWKLSA-N |
| XLogP | 2.39 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|