C20H30ClN7O — CID 163028939
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-[2-chloro-6-(dimethylamino)purin-9-yl]-N-methylacetamide (PubChem CID 163028939) has the molecular formula C20H30ClN7O and a molecular weight of 419.96 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-[2-chloro-6-(dimethylamino)purin-9-yl]-N-methylacetamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-[2-chloro-6-(dimethylamino)purin-9-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 163028939 |
| Molecular Formula | C20H30ClN7O |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-[2-chloro-6-(dimethylamino)purin-9-yl]-N-methylacetamide |
| SMILES | CN(CC1CCCN2CCCCC12)C(=O)Cn1cnc2c(N(C)C)nc(Cl)nc21 |
| InChI | InChI=1S/C20H30ClN7O/c1-25(2)18-17-19(24-20(21)23-18)28(13-22-17)12-16(29)26(3)11-14-7-6-10-27-9-5-4-8-15(14)27/h13-15H,4-12H2,1-3H3 |
| InChIKey | YPKAQQUWYZQEGT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |