C17H22O5 — CID 163034838
(5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) 4-acetyloxy-3-methylbut-2-enoate (PubChem CID 163034838) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) 4-acetyloxy-3-methylbut-2-enoate.
| Compound Name | (5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) 4-acetyloxy-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 163034838 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (5-formyl-2,6,6-trimethylcyclohexa-2,4-dien-1-yl) 4-acetyloxy-3-methylbut-2-enoate |
| SMILES | CC(=O)OCC(C)=CC(=O)OC1C(C)=CC=C(C=O)C1(C)C |
| InChI | InChI=1S/C17H22O5/c1-11(10-21-13(3)19)8-15(20)22-16-12(2)6-7-14(9-18)17(16,4)5/h6-9,16H,10H2,1-5H3 |
| InChIKey | UGWAKJANSZEVRT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|