C18H17NO4 — CID 163035614
(9S,12S,13S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-9,13-diol (PubChem CID 163035614) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (9S,12S,13S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-9,13-diol.
| Compound Name | (9S,12S,13S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-9,13-diol |
|---|---|
| PubChem CID | 163035614 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (9S,12S,13S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-9,13-diol |
| SMILES | CN1C[C@@H](O)c2cc3c(c4c2[C@H]1[C@@H](O)c1ccccc1-4)OCO3 |
| InChI | InChI=1S/C18H17NO4/c1-19-7-12(20)11-6-13-18(23-8-22-13)15-9-4-2-3-5-10(9)17(21)16(19)14(11)15/h2-6,12,16-17,20-21H,7-8H2,1H3/t12-,16+,17+/m1/s1 |
| InChIKey | PZXWMNOBRNEMCF-DQYPLSBCSA-N |
| XLogP | 2.15 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |