C17H31NO3 — CID 163035682
N-[4-[(E,2R,5R)-5-hydroxy-2-methoxy-6-methylhept-3-en-2-yl]-1-methylcyclohexyl]formamide (PubChem CID 163035682) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is N-[4-[(E,2R,5R)-5-hydroxy-2-methoxy-6-methylhept-3-en-2-yl]-1-methylcyclohexyl]formamide.
| Compound Name | N-[4-[(E,2R,5R)-5-hydroxy-2-methoxy-6-methylhept-3-en-2-yl]-1-methylcyclohexyl]formamide |
|---|---|
| PubChem CID | 163035682 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | N-[4-[(E,2R,5R)-5-hydroxy-2-methoxy-6-methylhept-3-en-2-yl]-1-methylcyclohexyl]formamide |
| SMILES | CO[C@@](C)(/C=C/[C@H](O)C(C)C)C1CCC(C)(NC=O)CC1 |
| InChI | InChI=1S/C17H31NO3/c1-13(2)15(20)8-11-17(4,21-5)14-6-9-16(3,10-7-14)18-12-19/h8,11-15,20H,6-7,9-10H2,1-5H3,(H,18,19)/b11-8+/t14?,15-,16?,17-/m0/s1 |
| InChIKey | GWYOMVLIZRMWIS-CJWGFFDYSA-N |
| XLogP | 2.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|