C22H28N2O3 — CID 163040245
1-[(1R,9R,11R,17R)-18-ethylidene-6-hydroxy-5-methoxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]propan-1-one (PubChem CID 163040245) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(1R,9R,11R,17R)-18-ethylidene-6-hydroxy-5-methoxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]propan-1-one.
| Compound Name | 1-[(1R,9R,11R,17R)-18-ethylidene-6-hydroxy-5-methoxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]propan-1-one |
|---|---|
| PubChem CID | 163040245 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[(1R,9R,11R,17R)-18-ethylidene-6-hydroxy-5-methoxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]propan-1-one |
| SMILES | CC=C1[C@@H]2CCN3CC[C@]4(c5ccc(OC)c(O)c5N(C(=O)CC)[C@@H]4C2)[C@@H]13 |
| InChI | InChI=1S/C22H28N2O3/c1-4-14-13-8-10-23-11-9-22(21(14)23)15-6-7-16(27-3)20(26)19(15)24(17(22)12-13)18(25)5-2/h4,6-7,13,17,21,26H,5,8-12H2,1-3H3/t13-,17-,21-,22-/m1/s1 |
| InChIKey | QZOWXKDNCYWNHV-CMEPALEVSA-N |
| XLogP | 3.21 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|