C17H14N2O2 — CID 163043227
(12S)-3,5-dioxa-11,13-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,13,15,17,19-heptaene (PubChem CID 163043227) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (12S)-3,5-dioxa-11,13-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,13,15,17,19-heptaene.
| Compound Name | (12S)-3,5-dioxa-11,13-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,13,15,17,19-heptaene |
|---|---|
| PubChem CID | 163043227 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (12S)-3,5-dioxa-11,13-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,13,15,17,19-heptaene |
| SMILES | C1=N[C@@H]2NCCc3cc4c(c(c32)-c2ccccc21)OCO4 |
| InChI | InChI=1S/C17H14N2O2/c1-2-4-12-11(3-1)8-19-17-14-10(5-6-18-17)7-13-16(15(12)14)21-9-20-13/h1-4,7-8,17-18H,5-6,9H2/t17-/m0/s1 |
| InChIKey | FVJYZKQVERELJV-KRWDZBQOSA-N |
| XLogP | 2.66 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |