C43H55ClO4 — CID 163052284
[3-hydroxy-2-(9-methyldecyl)-5-pentylphenyl] 15-(3-chloro-4-hydroxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate (PubChem CID 163052284) has the molecular formula C43H55ClO4 and a molecular weight of 671.36 g/mol. Its IUPAC name is [3-hydroxy-2-(9-methyldecyl)-5-pentylphenyl] 15-(3-chloro-4-hydroxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate.
| Compound Name | [3-hydroxy-2-(9-methyldecyl)-5-pentylphenyl] 15-(3-chloro-4-hydroxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate |
|---|---|
| PubChem CID | 163052284 |
| Molecular Formula | C43H55ClO4 |
| Molecular Weight | 671.36 g/mol |
| Exact Mass | 670.38 |
| IUPAC Name | [3-hydroxy-2-(9-methyldecyl)-5-pentylphenyl] 15-(3-chloro-4-hydroxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate |
| SMILES | CCCCCc1cc(O)c(CCCCCCCCC(C)C)c(OC(=O)C=CC=CC=CC=CC=CC=CC=Cc2ccc(O)c(Cl)c2)c1 |
| InChI | InChI=1S/C43H55ClO4/c1-4-5-20-27-37-33-41(46)38(28-23-18-15-14-16-21-25-35(2)3)42(34-37)48-43(47)29-24-19-13-11-9-7-6-8-10-12-17-22-26-36-30-31-40(45)39(44)32-36/h6-13,17,19,22,24,26,29-35,45-46H,4-5,14-16,18,20-21,23,25,27-28H2,1-3H3 |
| InChIKey | MOQRGTHMDIJREJ-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.36 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|