C44H57ClO4 — CID 101288355
(2-decyl-3-methoxy-5-pentylphenyl) (2E,4E,6E,8E,10E,12E,14E)-15-(3-chloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate (PubChem CID 101288355) has the molecular formula C44H57ClO4 and a molecular weight of 685.39 g/mol. Its IUPAC name is (2-decyl-3-methoxy-5-pentylphenyl) (2E,4E,6E,8E,10E,12E,14E)-15-(3-chloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate.
| Compound Name | (2-decyl-3-methoxy-5-pentylphenyl) (2E,4E,6E,8E,10E,12E,14E)-15-(3-chloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate |
|---|---|
| PubChem CID | 101288355 |
| Molecular Formula | C44H57ClO4 |
| Molecular Weight | 685.39 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | (2-decyl-3-methoxy-5-pentylphenyl) (2E,4E,6E,8E,10E,12E,14E)-15-(3-chloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate |
| SMILES | CCCCCCCCCCc1c(OC)cc(CCCCC)cc1OC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C44H57ClO4/c1-5-7-9-10-11-19-22-26-30-39-42(48-4)35-38(29-24-8-6-2)36-43(39)49-44(46)31-27-23-20-17-15-13-12-14-16-18-21-25-28-37-32-33-41(47-3)40(45)34-37/h12-18,20-21,23,25,27-28,31-36H,5-11,19,22,24,26,29-30H2,1-4H3/b13-12+,16-14+,17-15+,21-18+,23-20+,28-25+,31-27+ |
| InChIKey | XMEQBYQYNLQJKW-YWQQEQLZSA-N |
| XLogP | 12.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.39 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|