C39H52O4 — CID 163036348
[2-decyl-3-hydroxy-5-(4-methylpentyl)phenyl] 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoate (PubChem CID 163036348) has the molecular formula C39H52O4 and a molecular weight of 584.84 g/mol. Its IUPAC name is [2-decyl-3-hydroxy-5-(4-methylpentyl)phenyl] 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoate.
| Compound Name | [2-decyl-3-hydroxy-5-(4-methylpentyl)phenyl] 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 163036348 |
| Molecular Formula | C39H52O4 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | [2-decyl-3-hydroxy-5-(4-methylpentyl)phenyl] 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoate |
| SMILES | CCCCCCCCCCc1c(O)cc(CCCC(C)C)cc1OC(=O)C=CC=CC=CC=CC=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C39H52O4/c1-4-5-6-7-8-12-15-18-24-36-37(41)30-34(23-20-21-32(2)3)31-38(36)43-39(42)25-19-16-13-10-9-11-14-17-22-33-26-28-35(40)29-27-33/h9-11,13-14,16-17,19,22,25-32,40-41H,4-8,12,15,18,20-21,23-24H2,1-3H3 |
| InChIKey | BXCCZKVECWBUJG-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|