C48H64O4 — CID 613626
[3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] 17-(4-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoate (PubChem CID 613626) has the molecular formula C48H64O4 and a molecular weight of 705.04 g/mol. Its IUPAC name is [3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] 17-(4-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoate.
| Compound Name | [3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] 17-(4-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoate |
|---|---|
| PubChem CID | 613626 |
| Molecular Formula | C48H64O4 |
| Molecular Weight | 705.04 g/mol |
| Exact Mass | 704.48 |
| IUPAC Name | [3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] 17-(4-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoate |
| SMILES | COc1ccc(C=CC=CC=CC=CC=CC=CC=CC=CC(=O)Oc2cc(CCCC(C)C)cc(OC)c2CCCCCCCCC(C)C)cc1 |
| InChI | InChI=1S/C48H64O4/c1-40(2)28-23-19-17-18-21-25-32-45-46(51-6)38-43(31-27-29-41(3)4)39-47(45)52-48(49)33-26-22-16-14-12-10-8-7-9-11-13-15-20-24-30-42-34-36-44(50-5)37-35-42/h7-16,20,22,24,26,30,33-41H,17-19,21,23,25,27-29,31-32H2,1-6H3 |
| InChIKey | GPPDEBSQWRNLRZ-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.04 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|