C46H60Cl2O4 — CID 5376346
[3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] (2E,4E,6E,8E,10E,12E,14E)-15-(3,5-dichloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate (PubChem CID 5376346) has the molecular formula C46H60Cl2O4 and a molecular weight of 747.89 g/mol. Its IUPAC name is [3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] (2E,4E,6E,8E,10E,12E,14E)-15-(3,5-dichloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate.
| Compound Name | [3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] (2E,4E,6E,8E,10E,12E,14E)-15-(3,5-dichloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate |
|---|---|
| PubChem CID | 5376346 |
| Molecular Formula | C46H60Cl2O4 |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 746.39 |
| IUPAC Name | [3-methoxy-2-(9-methyldecyl)-5-(4-methylpentyl)phenyl] (2E,4E,6E,8E,10E,12E,14E)-15-(3,5-dichloro-4-methoxyphenyl)pentadeca-2,4,6,8,10,12,14-heptaenoate |
| SMILES | COc1cc(CCCC(C)C)cc(OC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/c2cc(Cl)c(OC)c(Cl)c2)c1CCCCCCCCC(C)C |
| InChI | InChI=1S/C46H60Cl2O4/c1-36(2)26-21-17-15-16-19-23-30-40-43(50-5)34-39(29-25-27-37(3)4)35-44(40)52-45(49)31-24-20-14-12-10-8-7-9-11-13-18-22-28-38-32-41(47)46(51-6)42(48)33-38/h7-14,18,20,22,24,28,31-37H,15-17,19,21,23,25-27,29-30H2,1-6H3/b8-7+,11-9+,12-10+,18-13+,20-14+,28-22+,31-24+ |
| InChIKey | DTYZVYDOJOETIY-ISIXAEKRSA-N |
| XLogP | 13.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|