C31H49N3O5 — CID 163053887
6-benzyl-3-butan-2-yl-13-octan-2-yl-9-propan-2-yl-1-oxa-2,5,8-triazacyclotridecane-4,7,10,11-tetrone (PubChem CID 163053887) has the molecular formula C31H49N3O5 and a molecular weight of 543.75 g/mol. Its IUPAC name is 6-benzyl-3-butan-2-yl-13-octan-2-yl-9-propan-2-yl-1-oxa-2,5,8-triazacyclotridecane-4,7,10,11-tetrone.
| Compound Name | 6-benzyl-3-butan-2-yl-13-octan-2-yl-9-propan-2-yl-1-oxa-2,5,8-triazacyclotridecane-4,7,10,11-tetrone |
|---|---|
| PubChem CID | 163053887 |
| Molecular Formula | C31H49N3O5 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.37 |
| IUPAC Name | 6-benzyl-3-butan-2-yl-13-octan-2-yl-9-propan-2-yl-1-oxa-2,5,8-triazacyclotridecane-4,7,10,11-tetrone |
| SMILES | CCCCCCC(C)C1CC(=O)C(=O)C(C(C)C)NC(=O)C(Cc2ccccc2)NC(=O)C(C(C)CC)NO1 |
| InChI | InChI=1S/C31H49N3O5/c1-7-9-10-12-15-22(6)26-19-25(35)29(36)27(20(3)4)33-30(37)24(18-23-16-13-11-14-17-23)32-31(38)28(34-39-26)21(5)8-2/h11,13-14,16-17,20-22,24,26-28,34H,7-10,12,15,18-19H2,1-6H3,(H,32,38)(H,33,37) |
| InChIKey | ROFGCSVVNJUPFF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|