C23H32O5 — CID 163059586
2,4-dihydroxy-3-[(4S)-4-hydroxy-3-methyl-5-[(1S,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde (PubChem CID 163059586) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2,4-dihydroxy-3-[(4S)-4-hydroxy-3-methyl-5-[(1S,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde.
| Compound Name | 2,4-dihydroxy-3-[(4S)-4-hydroxy-3-methyl-5-[(1S,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 163059586 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2,4-dihydroxy-3-[(4S)-4-hydroxy-3-methyl-5-[(1S,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde |
| SMILES | CC(=CCc1c(O)cc(C)c(C=O)c1O)[C@@H](O)C[C@@]1(C)[C@H](C)CCC(=O)[C@@H]1C |
| InChI | InChI=1S/C23H32O5/c1-13(6-8-17-20(26)10-14(2)18(12-24)22(17)28)21(27)11-23(5)15(3)7-9-19(25)16(23)4/h6,10,12,15-16,21,26-28H,7-9,11H2,1-5H3/t15-,16+,21+,23+/m1/s1 |
| InChIKey | BQAWIDAQBDWCGH-BTPZQINSSA-N |
| XLogP | 4.10 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|