C27H35ClO6 — CID 10117298
4-[2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)penta-2,4-dienyl]phenoxy]butanoic acid (PubChem CID 10117298) has the molecular formula C27H35ClO6 and a molecular weight of 491.02 g/mol. Its IUPAC name is 4-[2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)penta-2,4-dienyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)penta-2,4-dienyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 10117298 |
| Molecular Formula | C27H35ClO6 |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 4-[2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)penta-2,4-dienyl]phenoxy]butanoic acid |
| SMILES | CC(/C=C/C1(C)C(C)CCC(=O)C1C)=C\Cc1c(O)c(C=O)c(C)c(Cl)c1OCCCC(=O)O |
| InChI | InChI=1S/C27H35ClO6/c1-16(12-13-27(5)17(2)9-11-22(30)19(27)4)8-10-20-25(33)21(15-29)18(3)24(28)26(20)34-14-6-7-23(31)32/h8,12-13,15,17,19,33H,6-7,9-11,14H2,1-5H3,(H,31,32)/b13-12+,16-8+ |
| InChIKey | PKRFYGRDVQIVAQ-KTZJMSHLSA-N |
| XLogP | 6.10 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|