C26H35ClN2O4 — CID 135544315
2-[[5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl]methylideneamino]acetamide (PubChem CID 135544315) has the molecular formula C26H35ClN2O4 and a molecular weight of 475.03 g/mol. Its IUPAC name is 2-[[5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 135544315 |
| Molecular Formula | C26H35ClN2O4 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[[5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl]methylideneamino]acetamide |
| SMILES | COc1c(Cl)c(C)c(/C=N/CC(N)=O)c(O)c1C/C=C(C)/C=C/[C@@]1(C)[C@H](C)CCC(=O)[C@@H]1C |
| InChI | InChI=1S/C26H35ClN2O4/c1-15(11-12-26(5)16(2)8-10-21(30)18(26)4)7-9-19-24(32)20(13-29-14-22(28)31)17(3)23(27)25(19)33-6/h7,11-13,16,18,32H,8-10,14H2,1-6H3,(H2,28,31)/b12-11+,15-7+,29-13+/t16-,18+,26+/m1/s1 |
| InChIKey | TZNNLGJVAPMMPV-FUACYCRLSA-N |
| XLogP | 4.95 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|