C23H31ClO5 — CID 172883269
5-chloro-2,4-dihydroxy-3-[(E)-2-hydroxy-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)pent-3-enyl]-6-methylbenzaldehyde (PubChem CID 172883269) has the molecular formula C23H31ClO5 and a molecular weight of 422.95 g/mol. Its IUPAC name is 5-chloro-2,4-dihydroxy-3-[(E)-2-hydroxy-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)pent-3-enyl]-6-methylbenzaldehyde.
| Compound Name | 5-chloro-2,4-dihydroxy-3-[(E)-2-hydroxy-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)pent-3-enyl]-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 172883269 |
| Molecular Formula | C23H31ClO5 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 5-chloro-2,4-dihydroxy-3-[(E)-2-hydroxy-3-methyl-5-(1,2,6-trimethyl-3-oxocyclohexyl)pent-3-enyl]-6-methylbenzaldehyde |
| SMILES | C/C(=C\CC1(C)C(C)CCC(=O)C1C)C(O)Cc1c(O)c(Cl)c(C)c(C=O)c1O |
| InChI | InChI=1S/C23H31ClO5/c1-12(8-9-23(5)13(2)6-7-18(26)15(23)4)19(27)10-16-21(28)17(11-25)14(3)20(24)22(16)29/h8,11,13,15,19,27-29H,6-7,9-10H2,1-5H3/b12-8+ |
| InChIKey | BOOMDDPJDDUVDC-XYOKQWHBSA-N |
| XLogP | 4.75 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|