C23H31ClO6 — CID 125416233
5-chloro-2,4-dihydroxy-3-[(E,4R)-4-hydroxy-3-(hydroxymethyl)-5-[(1R,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde (PubChem CID 125416233) has the molecular formula C23H31ClO6 and a molecular weight of 438.95 g/mol. Its IUPAC name is 5-chloro-2,4-dihydroxy-3-[(E,4R)-4-hydroxy-3-(hydroxymethyl)-5-[(1R,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde.
| Compound Name | 5-chloro-2,4-dihydroxy-3-[(E,4R)-4-hydroxy-3-(hydroxymethyl)-5-[(1R,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 125416233 |
| Molecular Formula | C23H31ClO6 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 5-chloro-2,4-dihydroxy-3-[(E,4R)-4-hydroxy-3-(hydroxymethyl)-5-[(1R,2S,6R)-1,2,6-trimethyl-3-oxocyclohexyl]pent-2-enyl]-6-methylbenzaldehyde |
| SMILES | Cc1c(Cl)c(O)c(C/C=C(\CO)[C@H](O)C[C@]2(C)[C@H](C)CCC(=O)[C@H]2C)c(O)c1C=O |
| InChI | InChI=1S/C23H31ClO6/c1-12-5-8-18(27)14(3)23(12,4)9-19(28)15(10-25)6-7-16-21(29)17(11-26)13(2)20(24)22(16)30/h6,11-12,14,19,25,28-30H,5,7-10H2,1-4H3/b15-6+/t12-,14-,19-,23-/m1/s1 |
| InChIKey | HDMBFAOOJCPAHR-SOLRKFQYSA-N |
| XLogP | 3.73 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|