C15H22O5 — CID 163065743
4a-hydroxy-2,3,7,8,9-pentamethyl-3,5,8,9-tetrahydro-2H-furo[3,2-i][1,4]benzodioxin-6-one (PubChem CID 163065743) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4a-hydroxy-2,3,7,8,9-pentamethyl-3,5,8,9-tetrahydro-2H-furo[3,2-i][1,4]benzodioxin-6-one.
| Compound Name | 4a-hydroxy-2,3,7,8,9-pentamethyl-3,5,8,9-tetrahydro-2H-furo[3,2-i][1,4]benzodioxin-6-one |
|---|---|
| PubChem CID | 163065743 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4a-hydroxy-2,3,7,8,9-pentamethyl-3,5,8,9-tetrahydro-2H-furo[3,2-i][1,4]benzodioxin-6-one |
| SMILES | CC1=C2C(C)C(C)OC23OC(C)C(C)OC3(O)CC1=O |
| InChI | InChI=1S/C15H22O5/c1-7-9(3)19-15-13(7)8(2)12(16)6-14(15,17)18-10(4)11(5)20-15/h7,9-11,17H,6H2,1-5H3 |
| InChIKey | ZKJBPMKFQZIISQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |