C19H20O6 — CID 163084301
(4aS,9aR)-1,2,6-trihydroxy-5-methoxy-7-(3-methylbut-2-enyl)-4a,9a-dihydroxanthen-9-one (PubChem CID 163084301) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (4aS,9aR)-1,2,6-trihydroxy-5-methoxy-7-(3-methylbut-2-enyl)-4a,9a-dihydroxanthen-9-one.
| Compound Name | (4aS,9aR)-1,2,6-trihydroxy-5-methoxy-7-(3-methylbut-2-enyl)-4a,9a-dihydroxanthen-9-one |
|---|---|
| PubChem CID | 163084301 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4aS,9aR)-1,2,6-trihydroxy-5-methoxy-7-(3-methylbut-2-enyl)-4a,9a-dihydroxanthen-9-one |
| SMILES | COc1c(O)c(CC=C(C)C)cc2c1O[C@H]1C=CC(O)=C(O)[C@@H]1C2=O |
| InChI | InChI=1S/C19H20O6/c1-9(2)4-5-10-8-11-16(22)14-13(7-6-12(20)17(14)23)25-18(11)19(24-3)15(10)21/h4,6-8,13-14,20-21,23H,5H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | SAOPYSFGZIRXJJ-KBPBESRZSA-N |
| XLogP | 3.37 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|