C27H24O5 — CID 163086598
6-(3,4-dihydroxyphenyl)-5-(3,5-dihydroxyphenyl)-3-(2-phenylethenyl)cyclohept-2-en-1-one (PubChem CID 163086598) has the molecular formula C27H24O5 and a molecular weight of 428.48 g/mol. Its IUPAC name is 6-(3,4-dihydroxyphenyl)-5-(3,5-dihydroxyphenyl)-3-(2-phenylethenyl)cyclohept-2-en-1-one.
| Compound Name | 6-(3,4-dihydroxyphenyl)-5-(3,5-dihydroxyphenyl)-3-(2-phenylethenyl)cyclohept-2-en-1-one |
|---|---|
| PubChem CID | 163086598 |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 6-(3,4-dihydroxyphenyl)-5-(3,5-dihydroxyphenyl)-3-(2-phenylethenyl)cyclohept-2-en-1-one |
| SMILES | O=C1C=C(C=Cc2ccccc2)CC(c2cc(O)cc(O)c2)C(c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C27H24O5/c28-21-10-18(7-6-17-4-2-1-3-5-17)11-24(20-12-22(29)15-23(30)13-20)25(16-21)19-8-9-26(31)27(32)14-19/h1-10,12-15,24-25,29-32H,11,16H2 |
| InChIKey | YWRWOKCDBFSFCZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|