C23H21NO5 — CID 163757250
2-(3,4-dihydroxyphenyl)-8-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoline-3,5,7-triol (PubChem CID 163757250) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-8-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoline-3,5,7-triol.
| Compound Name | 2-(3,4-dihydroxyphenyl)-8-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoline-3,5,7-triol |
|---|---|
| PubChem CID | 163757250 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-8-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoline-3,5,7-triol |
| SMILES | Oc1ccc(C2Nc3c(/C=C/c4ccccc4)c(O)cc(O)c3CC2O)cc1O |
| InChI | InChI=1S/C23H21NO5/c25-17-9-7-14(10-20(17)28)22-21(29)11-16-19(27)12-18(26)15(23(16)24-22)8-6-13-4-2-1-3-5-13/h1-10,12,21-22,24-29H,11H2/b8-6+ |
| InChIKey | LVDKZOKOFZHFGS-SOFGYWHQSA-N |
| XLogP | 3.75 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|