C24H18O9 — CID 163097924
3-[4-[[(2R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-6-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 163097924) has the molecular formula C24H18O9 and a molecular weight of 450.40 g/mol. Its IUPAC name is 3-[4-[[(2R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-6-yl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[(2R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-6-yl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163097924 |
| Molecular Formula | C24H18O9 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 3-[4-[[(2R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-6-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(Oc2c(O)cc3c(c2O)C(=O)C[C@H](c2ccc(O)c(O)c2)O3)cc1 |
| InChI | InChI=1S/C24H18O9/c25-15-7-4-13(9-16(15)26)19-10-17(27)22-20(33-19)11-18(28)24(23(22)31)32-14-5-1-12(2-6-14)3-8-21(29)30/h1-9,11,19,25-26,28,31H,10H2,(H,29,30)/t19-/m1/s1 |
| InChIKey | SWMNWOAIJQBMDA-LJQANCHMSA-N |
| XLogP | 4.11 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|