C20H25NO3 — CID 163103334
5-methyl-12-methylidene-20-oxa-7-azaoctacyclo[9.6.2.13,6.01,8.05,17.07,16.09,14.014,18]icosane-10,19-diol (PubChem CID 163103334) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 5-methyl-12-methylidene-20-oxa-7-azaoctacyclo[9.6.2.13,6.01,8.05,17.07,16.09,14.014,18]icosane-10,19-diol.
| Compound Name | 5-methyl-12-methylidene-20-oxa-7-azaoctacyclo[9.6.2.13,6.01,8.05,17.07,16.09,14.014,18]icosane-10,19-diol |
|---|---|
| PubChem CID | 163103334 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 5-methyl-12-methylidene-20-oxa-7-azaoctacyclo[9.6.2.13,6.01,8.05,17.07,16.09,14.014,18]icosane-10,19-diol |
| SMILES | C=C1CC23CC4C5C6(C)CC7CC58C(C2C(O)C1C(O)C38)N4C6O7 |
| InChI | InChI=1S/C20H25NO3/c1-7-3-19-6-9-14-18(2)4-8-5-20(14)15(19)13(23)10(7)12(22)11(19)16(20)21(9)17(18)24-8/h8-17,22-23H,1,3-6H2,2H3 |
| InChIKey | AESOLDZPRLNDJZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|