C32H52O6 — CID 163108284
16-(6-ethoxy-5-hydroxy-6-methylheptan-2-yl)-8-hydroxy-7,7,11,15-tetramethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosan-19-one (PubChem CID 163108284) has the molecular formula C32H52O6 and a molecular weight of 532.76 g/mol. Its IUPAC name is 16-(6-ethoxy-5-hydroxy-6-methylheptan-2-yl)-8-hydroxy-7,7,11,15-tetramethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosan-19-one.
| Compound Name | 16-(6-ethoxy-5-hydroxy-6-methylheptan-2-yl)-8-hydroxy-7,7,11,15-tetramethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosan-19-one |
|---|---|
| PubChem CID | 163108284 |
| Molecular Formula | C32H52O6 |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | 16-(6-ethoxy-5-hydroxy-6-methylheptan-2-yl)-8-hydroxy-7,7,11,15-tetramethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosan-19-one |
| SMILES | CCOC(C)(C)C(O)CCC(C)C1CCC23C(=O)OC4(CCC12C)C1(C)CCC(O)C(C)(C)C1CC1OC143 |
| InChI | InChI=1S/C32H52O6/c1-9-36-27(5,6)23(34)11-10-19(2)20-12-15-30-25(35)38-31(17-16-28(20,30)7)29(8)14-13-22(33)26(3,4)21(29)18-24-32(30,31)37-24/h19-24,33-34H,9-18H2,1-8H3 |
| InChIKey | DMMSYNAFYVQAOC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|