C29H42O5 — CID 102585496
(1S,2S,4S,6S,7S,11S,12S,15R,16R)-16-[(Z,2R)-5-hydroxy-6-methylhept-4-en-2-yl]-7,11,15-trimethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione (PubChem CID 102585496) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is (1S,2S,4S,6S,7S,11S,12S,15R,16R)-16-[(Z,2R)-5-hydroxy-6-methylhept-4-en-2-yl]-7,11,15-trimethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione.
| Compound Name | (1S,2S,4S,6S,7S,11S,12S,15R,16R)-16-[(Z,2R)-5-hydroxy-6-methylhept-4-en-2-yl]-7,11,15-trimethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione |
|---|---|
| PubChem CID | 102585496 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (1S,2S,4S,6S,7S,11S,12S,15R,16R)-16-[(Z,2R)-5-hydroxy-6-methylhept-4-en-2-yl]-7,11,15-trimethyl-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione |
| SMILES | CC(C)/C(O)=C/C[C@@H](C)[C@H]1CC[C@]23C(=O)O[C@]4(CC[C@]12C)[C@]31O[C@H]1C[C@H]1[C@H](C)C(=O)CC[C@@]14C |
| InChI | InChI=1S/C29H42O5/c1-16(2)21(30)8-7-17(3)19-9-12-27-24(32)34-28(14-13-25(19,27)5)26(6)11-10-22(31)18(4)20(26)15-23-29(27,28)33-23/h8,16-20,23,30H,7,9-15H2,1-6H3/b21-8-/t17-,18+,19-,20+,23+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | QGXVSNGADOJIEP-UPZXOWTMSA-N |
| XLogP | 5.77 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|