C30H44O4 — CID 163085179
7,7,11,15-tetramethyl-16-(6-methylhept-5-en-2-yl)-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione (PubChem CID 163085179) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is 7,7,11,15-tetramethyl-16-(6-methylhept-5-en-2-yl)-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione.
| Compound Name | 7,7,11,15-tetramethyl-16-(6-methylhept-5-en-2-yl)-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione |
|---|---|
| PubChem CID | 163085179 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 7,7,11,15-tetramethyl-16-(6-methylhept-5-en-2-yl)-3,20-dioxahexacyclo[10.6.2.01,15.02,4.02,12.06,11]icosane-8,19-dione |
| SMILES | CC(C)=CCCC(C)C1CCC23C(=O)OC4(CCC12C)C1(C)CCC(=O)C(C)(C)C1CC1OC143 |
| InChI | InChI=1S/C30H44O4/c1-18(2)9-8-10-19(3)20-11-14-28-24(32)34-29(16-15-26(20,28)6)27(7)13-12-22(31)25(4,5)21(27)17-23-30(28,29)33-23/h9,19-21,23H,8,10-17H2,1-7H3 |
| InChIKey | ULZHQBWERNNIDK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|