C29H32NO8- — CID 163123280
[2-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 163123280) has the molecular formula C29H32NO8- and a molecular weight of 522.57 g/mol. Its IUPAC name is [2-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [2-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 163123280 |
| Molecular Formula | C29H32NO8- |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [2-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OCc2ccc(N([O-])O)cc2)OC(C)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H32NO8/c1-20-26(34-17-22-9-5-3-6-10-22)27(35-18-23-11-7-4-8-12-23)28(38-21(2)31)29(37-20)36-19-24-13-15-25(16-14-24)30(32)33/h3-16,20,26-29,32H,17-19H2,1-2H3/q-1 |
| InChIKey | IXTKBCQNEOKMLU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|